About 2-[3,5-bis(2-sulfanylethyl)cyclohexyl]ethanethiol
2-[3,5-bis(2-sulfanylethyl)cyclohexyl]ethanethiol (PubChem CID 20502924) has the molecular formula C12H24S3
and a molecular weight of 264.52 g/mol. Its IUPAC name is 2-[3,5-bis(2-sulfanylethyl)cyclohexyl]ethanethiol.
Molecular Properties
| Compound Name | 2-[3,5-bis(2-sulfanylethyl)cyclohexyl]ethanethiol |
| PubChem CID | 20502924 |
| Molecular Formula | C12H24S3 |
| Molecular Weight | 264.52 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2-[3,5-bis(2-sulfanylethyl)cyclohexyl]ethanethiol |
| SMILES | SCCC1CC(CCS)CC(CCS)C1 |
| InChI | InChI=1S/C12H24S3/c13-4-1-10-7-11(2-5-14)9-12(8-10)3-6-15/h10-15H,1-9H2 |
| InChIKey | ZQOVVELQGJITAR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[3,5-bis(2-sulfanylethyl)cyclohexyl]ethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-bis(2-sulfanylethyl)cyclohexyl]ethanethiol?
The IUPAC name of 2-[3,5-bis(2-sulfanylethyl)cyclohexyl]ethanethiol (CID 20502924) is 2-[3,5-bis(2-sulfanylethyl)cyclohexyl]ethanethiol.
What is the SMILES notation for 2-[3,5-bis(2-sulfanylethyl)cyclohexyl]ethanethiol?
The canonical SMILES for 2-[3,5-bis(2-sulfanylethyl)cyclohexyl]ethanethiol is SCCC1CC(CCS)CC(CCS)C1.
What is the InChIKey of 2-[3,5-bis(2-sulfanylethyl)cyclohexyl]ethanethiol?
The InChIKey is ZQOVVELQGJITAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24S3/c13-4-1-10-7-11(2-5-14)9-12(8-10)3-6-15/h10-15H,1-9H2.
What are the key properties of 2-[3,5-bis(2-sulfanylethyl)cyclohexyl]ethanethiol?
2-[3,5-bis(2-sulfanylethyl)cyclohexyl]ethanethiol has a molecular weight of 264.52 g/mol, XLogP of 3.98, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-bis(2-sulfanylethyl)cyclohexyl]ethanethiol is sourced from PubChem (CID 20502924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).