C26H34O3 — CID 20503140
1-[4-(4-decoxyphenyl)phenyl]butane-1,3-dione (PubChem CID 20503140) has the molecular formula C26H34O3 and a molecular weight of 394.56 g/mol. Its IUPAC name is 1-[4-(4-decoxyphenyl)phenyl]butane-1,3-dione.
| Compound Name | 1-[4-(4-decoxyphenyl)phenyl]butane-1,3-dione |
|---|---|
| PubChem CID | 20503140 |
| Molecular Formula | C26H34O3 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | 1-[4-(4-decoxyphenyl)phenyl]butane-1,3-dione |
| SMILES | CCCCCCCCCCOc1ccc(-c2ccc(C(=O)CC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C26H34O3/c1-3-4-5-6-7-8-9-10-19-29-25-17-15-23(16-18-25)22-11-13-24(14-12-22)26(28)20-21(2)27/h11-18H,3-10,19-20H2,1-2H3 |
| InChIKey | PPAJLMWHDDXVJZ-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|