C21H22N2O5 — CID 2050329
4-[4-[2-(3-methylphenoxy)acetyl]piperazine-1-carbonyl]benzoic acid (PubChem CID 2050329) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is 4-[4-[2-(3-methylphenoxy)acetyl]piperazine-1-carbonyl]benzoic acid.
| Compound Name | 4-[4-[2-(3-methylphenoxy)acetyl]piperazine-1-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 2050329 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 4-[4-[2-(3-methylphenoxy)acetyl]piperazine-1-carbonyl]benzoic acid |
| SMILES | Cc1cccc(OCC(=O)N2CCN(C(=O)c3ccc(C(=O)O)cc3)CC2)c1 |
| InChI | InChI=1S/C21H22N2O5/c1-15-3-2-4-18(13-15)28-14-19(24)22-9-11-23(12-10-22)20(25)16-5-7-17(8-6-16)21(26)27/h2-8,13H,9-12,14H2,1H3,(H,26,27) |
| InChIKey | PLPLQIKAUHMNCA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |