About N-(2,3-dihydro-1H-1,4-benzodiazepin-2-ylmethyl)acetamide
N-(2,3-dihydro-1H-1,4-benzodiazepin-2-ylmethyl)acetamide (PubChem CID 20503352) has the molecular formula C12H15N3O
and a molecular weight of 217.27 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-1,4-benzodiazepin-2-ylmethyl)acetamide.
Molecular Properties
| Compound Name | N-(2,3-dihydro-1H-1,4-benzodiazepin-2-ylmethyl)acetamide |
| PubChem CID | 20503352 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | N-(2,3-dihydro-1H-1,4-benzodiazepin-2-ylmethyl)acetamide |
| SMILES | CC(=O)NCC1CN=Cc2ccccc2N1 |
| InChI | InChI=1S/C12H15N3O/c1-9(16)14-8-11-7-13-6-10-4-2-3-5-12(10)15-11/h2-6,11,15H,7-8H2,1H3,(H,14,16) |
| InChIKey | BIUIILLKOHTYMF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2,3-dihydro-1H-1,4-benzodiazepin-2-ylmethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dihydro-1H-1,4-benzodiazepin-2-ylmethyl)acetamide?
The IUPAC name of N-(2,3-dihydro-1H-1,4-benzodiazepin-2-ylmethyl)acetamide (CID 20503352) is N-(2,3-dihydro-1H-1,4-benzodiazepin-2-ylmethyl)acetamide.
What is the SMILES notation for N-(2,3-dihydro-1H-1,4-benzodiazepin-2-ylmethyl)acetamide?
The canonical SMILES for N-(2,3-dihydro-1H-1,4-benzodiazepin-2-ylmethyl)acetamide is CC(=O)NCC1CN=Cc2ccccc2N1.
What is the InChIKey of N-(2,3-dihydro-1H-1,4-benzodiazepin-2-ylmethyl)acetamide?
The InChIKey is BIUIILLKOHTYMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O/c1-9(16)14-8-11-7-13-6-10-4-2-3-5-12(10)15-11/h2-6,11,15H,7-8H2,1H3,(H,14,16).
What are the key properties of N-(2,3-dihydro-1H-1,4-benzodiazepin-2-ylmethyl)acetamide?
N-(2,3-dihydro-1H-1,4-benzodiazepin-2-ylmethyl)acetamide has a molecular weight of 217.27 g/mol, XLogP of 1.04, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dihydro-1H-1,4-benzodiazepin-2-ylmethyl)acetamide is sourced from PubChem (CID 20503352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).