About 2-ethoxycarbonyloxyethyl ethyl carbonate;1,4-xylene
2-ethoxycarbonyloxyethyl ethyl carbonate;1,4-xylene (PubChem CID 20503523) has the molecular formula C16H24O6
and a molecular weight of 312.36 g/mol. Its IUPAC name is 2-ethoxycarbonyloxyethyl ethyl carbonate;1,4-xylene.
Molecular Properties
| Compound Name | 2-ethoxycarbonyloxyethyl ethyl carbonate;1,4-xylene |
| PubChem CID | 20503523 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 2-ethoxycarbonyloxyethyl ethyl carbonate;1,4-xylene |
| SMILES | CCOC(=O)OCCOC(=O)OCC.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C8H14O6.C8H10/c1-3-11-7(9)13-5-6-14-8(10)12-4-2;1-7-3-5-8(2)6-4-7/h3-6H2,1-2H3;3-6H,1-2H3 |
| InChIKey | QYUSVFDAGMKSJM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxycarbonyloxyethyl ethyl carbonate;1,4-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxycarbonyloxyethyl ethyl carbonate;1,4-xylene?
The IUPAC name of 2-ethoxycarbonyloxyethyl ethyl carbonate;1,4-xylene (CID 20503523) is 2-ethoxycarbonyloxyethyl ethyl carbonate;1,4-xylene.
What is the SMILES notation for 2-ethoxycarbonyloxyethyl ethyl carbonate;1,4-xylene?
The canonical SMILES for 2-ethoxycarbonyloxyethyl ethyl carbonate;1,4-xylene is CCOC(=O)OCCOC(=O)OCC.Cc1ccc(C)cc1.
What is the InChIKey of 2-ethoxycarbonyloxyethyl ethyl carbonate;1,4-xylene?
The InChIKey is QYUSVFDAGMKSJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O6.C8H10/c1-3-11-7(9)13-5-6-14-8(10)12-4-2;1-7-3-5-8(2)6-4-7/h3-6H2,1-2H3;3-6H,1-2H3.
What are the key properties of 2-ethoxycarbonyloxyethyl ethyl carbonate;1,4-xylene?
2-ethoxycarbonyloxyethyl ethyl carbonate;1,4-xylene has a molecular weight of 312.36 g/mol, XLogP of 3.64, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxycarbonyloxyethyl ethyl carbonate;1,4-xylene is sourced from PubChem (CID 20503523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).