C18H33N3O11S2 — CID 20503682
4-(3,6-dibutoxy-4-diazocyclohexa-1,5-dien-1-yl)morpholine;sulfuric acid (PubChem CID 20503682) has the molecular formula C18H33N3O11S2 and a molecular weight of 531.61 g/mol. Its IUPAC name is 4-(3,6-dibutoxy-4-diazocyclohexa-1,5-dien-1-yl)morpholine;sulfuric acid.
| Compound Name | 4-(3,6-dibutoxy-4-diazocyclohexa-1,5-dien-1-yl)morpholine;sulfuric acid |
|---|---|
| PubChem CID | 20503682 |
| Molecular Formula | C18H33N3O11S2 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | 4-(3,6-dibutoxy-4-diazocyclohexa-1,5-dien-1-yl)morpholine;sulfuric acid |
| SMILES | CCCCOC1=CC(=[N+]=[N-])C(OCCCC)C=C1N1CCOCC1.O=S(=O)(O)O.O=S(=O)(O)O |
| InChI | InChI=1S/C18H29N3O3.2H2O4S/c1-3-5-9-23-17-14-16(21-7-11-22-12-8-21)18(13-15(17)20-19)24-10-6-4-2;2*1-5(2,3)4/h13-14,17H,3-12H2,1-2H3;2*(H2,1,2,3,4) |
| InChIKey | HMVSXCWVRBCMLG-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 216.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|