C11H5Cl4O4- — CID 20504076
2,3,4,5-tetrachloro-6-prop-2-enoxycarbonylbenzoate (PubChem CID 20504076) has the molecular formula C11H5Cl4O4- and a molecular weight of 342.97 g/mol. Its IUPAC name is 2,3,4,5-tetrachloro-6-prop-2-enoxycarbonylbenzoate.
| Compound Name | 2,3,4,5-tetrachloro-6-prop-2-enoxycarbonylbenzoate |
|---|---|
| PubChem CID | 20504076 |
| Molecular Formula | C11H5Cl4O4- |
| Molecular Weight | 342.97 g/mol |
| Exact Mass | 340.89 |
| IUPAC Name | 2,3,4,5-tetrachloro-6-prop-2-enoxycarbonylbenzoate |
| SMILES | C=CCOC(=O)c1c(Cl)c(Cl)c(Cl)c(Cl)c1C(=O)[O-] |
| InChI | InChI=1S/C11H6Cl4O4/c1-2-3-19-11(18)5-4(10(16)17)6(12)8(14)9(15)7(5)13/h2H,1,3H2,(H,16,17)/p-1 |
| InChIKey | PKPWHWSEFOJGEV-UHFFFAOYSA-M |
| XLogP | 3.01 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.97 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|