About 4-(oxolan-2-yl)-2,3-dihydrofuran
4-(oxolan-2-yl)-2,3-dihydrofuran (PubChem CID 20504360) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is 4-(oxolan-2-yl)-2,3-dihydrofuran.
Molecular Properties
| Compound Name | 4-(oxolan-2-yl)-2,3-dihydrofuran |
| PubChem CID | 20504360 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 4-(oxolan-2-yl)-2,3-dihydrofuran |
| SMILES | C1=C(C2CCCO2)CCO1 |
| InChI | InChI=1S/C8H12O2/c1-2-8(10-4-1)7-3-5-9-6-7/h6,8H,1-5H2 |
| InChIKey | WTWRAWKDRPTJPD-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(oxolan-2-yl)-2,3-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(oxolan-2-yl)-2,3-dihydrofuran?
The IUPAC name of 4-(oxolan-2-yl)-2,3-dihydrofuran (CID 20504360) is 4-(oxolan-2-yl)-2,3-dihydrofuran.
What is the SMILES notation for 4-(oxolan-2-yl)-2,3-dihydrofuran?
The canonical SMILES for 4-(oxolan-2-yl)-2,3-dihydrofuran is C1=C(C2CCCO2)CCO1.
What is the InChIKey of 4-(oxolan-2-yl)-2,3-dihydrofuran?
The InChIKey is WTWRAWKDRPTJPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O2/c1-2-8(10-4-1)7-3-5-9-6-7/h6,8H,1-5H2.
What are the key properties of 4-(oxolan-2-yl)-2,3-dihydrofuran?
4-(oxolan-2-yl)-2,3-dihydrofuran has a molecular weight of 140.18 g/mol, XLogP of 1.47, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(oxolan-2-yl)-2,3-dihydrofuran is sourced from PubChem (CID 20504360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).