About 4-methylpyrrol-2-one
4-methylpyrrol-2-one (PubChem CID 20504634) has the molecular formula C5H5NO
and a molecular weight of 95.10 g/mol. Its IUPAC name is 4-methylpyrrol-2-one.
Molecular Properties
| Compound Name | 4-methylpyrrol-2-one |
| PubChem CID | 20504634 |
| Molecular Formula | C5H5NO |
| Molecular Weight | 95.10 g/mol |
| Exact Mass | 95.04 |
| IUPAC Name | 4-methylpyrrol-2-one |
| SMILES | CC1=CC(=O)N=C1 |
| InChI | InChI=1S/C5H5NO/c1-4-2-5(7)6-3-4/h2-3H,1H3 |
| InChIKey | XUUYAAAYPXHVGP-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 95.10 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methylpyrrol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpyrrol-2-one?
The IUPAC name of 4-methylpyrrol-2-one (CID 20504634) is 4-methylpyrrol-2-one.
What is the SMILES notation for 4-methylpyrrol-2-one?
The canonical SMILES for 4-methylpyrrol-2-one is CC1=CC(=O)N=C1.
What is the InChIKey of 4-methylpyrrol-2-one?
The InChIKey is XUUYAAAYPXHVGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO/c1-4-2-5(7)6-3-4/h2-3H,1H3.
What are the key properties of 4-methylpyrrol-2-one?
4-methylpyrrol-2-one has a molecular weight of 95.10 g/mol, XLogP of 0.54, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpyrrol-2-one is sourced from PubChem (CID 20504634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).