About 2-chloro-5-diazo-3,6-diethoxycyclohexa-1,3-diene
2-chloro-5-diazo-3,6-diethoxycyclohexa-1,3-diene (PubChem CID 20504815) has the molecular formula C10H13ClN2O2
and a molecular weight of 228.68 g/mol. Its IUPAC name is 2-chloro-5-diazo-3,6-diethoxycyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 2-chloro-5-diazo-3,6-diethoxycyclohexa-1,3-diene |
| PubChem CID | 20504815 |
| Molecular Formula | C10H13ClN2O2 |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 2-chloro-5-diazo-3,6-diethoxycyclohexa-1,3-diene |
| SMILES | CCOC1=CC(=[N+]=[N-])C(OCC)C=C1Cl |
| InChI | InChI=1S/C10H13ClN2O2/c1-3-14-9-6-8(13-12)10(15-4-2)5-7(9)11/h5-6,10H,3-4H2,1-2H3 |
| InChIKey | QWKDRJUVSQGERP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 54.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-5-diazo-3,6-diethoxycyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-diazo-3,6-diethoxycyclohexa-1,3-diene?
The IUPAC name of 2-chloro-5-diazo-3,6-diethoxycyclohexa-1,3-diene (CID 20504815) is 2-chloro-5-diazo-3,6-diethoxycyclohexa-1,3-diene.
What is the SMILES notation for 2-chloro-5-diazo-3,6-diethoxycyclohexa-1,3-diene?
The canonical SMILES for 2-chloro-5-diazo-3,6-diethoxycyclohexa-1,3-diene is CCOC1=CC(=[N+]=[N-])C(OCC)C=C1Cl.
What is the InChIKey of 2-chloro-5-diazo-3,6-diethoxycyclohexa-1,3-diene?
The InChIKey is QWKDRJUVSQGERP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClN2O2/c1-3-14-9-6-8(13-12)10(15-4-2)5-7(9)11/h5-6,10H,3-4H2,1-2H3.
What are the key properties of 2-chloro-5-diazo-3,6-diethoxycyclohexa-1,3-diene?
2-chloro-5-diazo-3,6-diethoxycyclohexa-1,3-diene has a molecular weight of 228.68 g/mol, XLogP of 2.12, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-diazo-3,6-diethoxycyclohexa-1,3-diene is sourced from PubChem (CID 20504815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).