About 1-morpholin-2-yl-N,N-dipropylpropan-1-amine
1-morpholin-2-yl-N,N-dipropylpropan-1-amine (PubChem CID 20504825) has the molecular formula C13H28N2O
and a molecular weight of 228.38 g/mol. Its IUPAC name is 1-morpholin-2-yl-N,N-dipropylpropan-1-amine.
Molecular Properties
| Compound Name | 1-morpholin-2-yl-N,N-dipropylpropan-1-amine |
| PubChem CID | 20504825 |
| Molecular Formula | C13H28N2O |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.22 |
| IUPAC Name | 1-morpholin-2-yl-N,N-dipropylpropan-1-amine |
| SMILES | CCCN(CCC)C(CC)C1CNCCO1 |
| InChI | InChI=1S/C13H28N2O/c1-4-8-15(9-5-2)12(6-3)13-11-14-7-10-16-13/h12-14H,4-11H2,1-3H3 |
| InChIKey | DTEHIJBOGKFGCW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-morpholin-2-yl-N,N-dipropylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-morpholin-2-yl-N,N-dipropylpropan-1-amine?
The IUPAC name of 1-morpholin-2-yl-N,N-dipropylpropan-1-amine (CID 20504825) is 1-morpholin-2-yl-N,N-dipropylpropan-1-amine.
What is the SMILES notation for 1-morpholin-2-yl-N,N-dipropylpropan-1-amine?
The canonical SMILES for 1-morpholin-2-yl-N,N-dipropylpropan-1-amine is CCCN(CCC)C(CC)C1CNCCO1.
What is the InChIKey of 1-morpholin-2-yl-N,N-dipropylpropan-1-amine?
The InChIKey is DTEHIJBOGKFGCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2O/c1-4-8-15(9-5-2)12(6-3)13-11-14-7-10-16-13/h12-14H,4-11H2,1-3H3.
What are the key properties of 1-morpholin-2-yl-N,N-dipropylpropan-1-amine?
1-morpholin-2-yl-N,N-dipropylpropan-1-amine has a molecular weight of 228.38 g/mol, XLogP of 1.88, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-morpholin-2-yl-N,N-dipropylpropan-1-amine is sourced from PubChem (CID 20504825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).