About 1-morpholin-4-yl-N,N-bis(1-morpholin-4-ylpropyl)propan-1-amine
1-morpholin-4-yl-N,N-bis(1-morpholin-4-ylpropyl)propan-1-amine (PubChem CID 20504828) has the molecular formula C21H42N4O3
and a molecular weight of 398.59 g/mol. Its IUPAC name is 1-morpholin-4-yl-N,N-bis(1-morpholin-4-ylpropyl)propan-1-amine.
Molecular Properties
| Compound Name | 1-morpholin-4-yl-N,N-bis(1-morpholin-4-ylpropyl)propan-1-amine |
| PubChem CID | 20504828 |
| Molecular Formula | C21H42N4O3 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.33 |
| IUPAC Name | 1-morpholin-4-yl-N,N-bis(1-morpholin-4-ylpropyl)propan-1-amine |
| SMILES | CCC(N1CCOCC1)N(C(CC)N1CCOCC1)C(CC)N1CCOCC1 |
| InChI | InChI=1S/C21H42N4O3/c1-4-19(22-7-13-26-14-8-22)25(20(5-2)23-9-15-27-16-10-23)21(6-3)24-11-17-28-18-12-24/h19-21H,4-18H2,1-3H3 |
| InChIKey | KMURNAVOGVVYME-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 40.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-morpholin-4-yl-N,N-bis(1-morpholin-4-ylpropyl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-morpholin-4-yl-N,N-bis(1-morpholin-4-ylpropyl)propan-1-amine?
The IUPAC name of 1-morpholin-4-yl-N,N-bis(1-morpholin-4-ylpropyl)propan-1-amine (CID 20504828) is 1-morpholin-4-yl-N,N-bis(1-morpholin-4-ylpropyl)propan-1-amine.
What is the SMILES notation for 1-morpholin-4-yl-N,N-bis(1-morpholin-4-ylpropyl)propan-1-amine?
The canonical SMILES for 1-morpholin-4-yl-N,N-bis(1-morpholin-4-ylpropyl)propan-1-amine is CCC(N1CCOCC1)N(C(CC)N1CCOCC1)C(CC)N1CCOCC1.
What is the InChIKey of 1-morpholin-4-yl-N,N-bis(1-morpholin-4-ylpropyl)propan-1-amine?
The InChIKey is KMURNAVOGVVYME-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H42N4O3/c1-4-19(22-7-13-26-14-8-22)25(20(5-2)23-9-15-27-16-10-23)21(6-3)24-11-17-28-18-12-24/h19-21H,4-18H2,1-3H3.
What are the key properties of 1-morpholin-4-yl-N,N-bis(1-morpholin-4-ylpropyl)propan-1-amine?
1-morpholin-4-yl-N,N-bis(1-morpholin-4-ylpropyl)propan-1-amine has a molecular weight of 398.59 g/mol, XLogP of 1.49, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-morpholin-4-yl-N,N-bis(1-morpholin-4-ylpropyl)propan-1-amine is sourced from PubChem (CID 20504828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).