C16H11F7O2 — CID 20504864
4-[2,2,3,3,4,4,4-heptafluoro-1-(4-hydroxyphenyl)butyl]phenol (PubChem CID 20504864) has the molecular formula C16H11F7O2 and a molecular weight of 368.25 g/mol. Its IUPAC name is 4-[2,2,3,3,4,4,4-heptafluoro-1-(4-hydroxyphenyl)butyl]phenol.
| Compound Name | 4-[2,2,3,3,4,4,4-heptafluoro-1-(4-hydroxyphenyl)butyl]phenol |
|---|---|
| PubChem CID | 20504864 |
| Molecular Formula | C16H11F7O2 |
| Molecular Weight | 368.25 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 4-[2,2,3,3,4,4,4-heptafluoro-1-(4-hydroxyphenyl)butyl]phenol |
| SMILES | Oc1ccc(C(c2ccc(O)cc2)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H11F7O2/c17-14(18,15(19,20)16(21,22)23)13(9-1-5-11(24)6-2-9)10-3-7-12(25)8-4-10/h1-8,13,24-25H |
| InChIKey | FGDPEJHQCITKEK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.25 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|