methylsulfinylmethane;molecular hydrogen

C2H8OS — CID 20504873

IUPACmethylsulfinylmethane;molecular hydrogen
SMILESCS(C)=O.[H][H]
InChIInChI=1S/C2H6OS.H2/c1-4(2)3;/h1-2H3;1H
InChIKeyZNHLTMJEASSXJA-UHFFFAOYSA-N
MW80.15 g/mol
LogP0.24
Rot. Bonds

About methylsulfinylmethane;molecular hydrogen

methylsulfinylmethane;molecular hydrogen (PubChem CID 20504873) has the molecular formula C2H8OS and a molecular weight of 80.15 g/mol. Its IUPAC name is methylsulfinylmethane;molecular hydrogen.

Molecular Properties

Compound Namemethylsulfinylmethane;molecular hydrogen
PubChem CID20504873
Molecular FormulaC2H8OS
Molecular Weight80.15 g/mol
Exact Mass80.03
IUPAC Namemethylsulfinylmethane;molecular hydrogen
SMILESCS(C)=O.[H][H]
InChIInChI=1S/C2H6OS.H2/c1-4(2)3;/h1-2H3;1H
InChIKeyZNHLTMJEASSXJA-UHFFFAOYSA-N
XLogP0.24
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms4
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 50080.15
LogP ≤ 50.24
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Analyze methylsulfinylmethane;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methylsulfinylmethane;molecular hydrogen?
The IUPAC name of methylsulfinylmethane;molecular hydrogen (CID 20504873) is methylsulfinylmethane;molecular hydrogen.
What is the SMILES notation for methylsulfinylmethane;molecular hydrogen?
The canonical SMILES for methylsulfinylmethane;molecular hydrogen is CS(C)=O.[H][H].
What is the InChIKey of methylsulfinylmethane;molecular hydrogen?
The InChIKey is ZNHLTMJEASSXJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6OS.H2/c1-4(2)3;/h1-2H3;1H.
What are the key properties of methylsulfinylmethane;molecular hydrogen?
methylsulfinylmethane;molecular hydrogen has a molecular weight of 80.15 g/mol, XLogP of 0.24, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methylsulfinylmethane;molecular hydrogen is sourced from PubChem (CID 20504873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).