C15H17N3O4S — CID 20505050
4-oxo-1-propan-2-yl-N-(2-sulfanylethyl)-[1,3]dioxolo[4,5-g]cinnoline-3-carboxamide (PubChem CID 20505050) has the molecular formula C15H17N3O4S and a molecular weight of 335.39 g/mol. Its IUPAC name is 4-oxo-1-propan-2-yl-N-(2-sulfanylethyl)-[1,3]dioxolo[4,5-g]cinnoline-3-carboxamide.
| Compound Name | 4-oxo-1-propan-2-yl-N-(2-sulfanylethyl)-[1,3]dioxolo[4,5-g]cinnoline-3-carboxamide |
|---|---|
| PubChem CID | 20505050 |
| Molecular Formula | C15H17N3O4S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 4-oxo-1-propan-2-yl-N-(2-sulfanylethyl)-[1,3]dioxolo[4,5-g]cinnoline-3-carboxamide |
| SMILES | CC(C)n1nc(C(=O)NCCS)c(=O)c2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C15H17N3O4S/c1-8(2)18-10-6-12-11(21-7-22-12)5-9(10)14(19)13(17-18)15(20)16-3-4-23/h5-6,8,23H,3-4,7H2,1-2H3,(H,16,20) |
| InChIKey | WZDIOVAZWUYWFZ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|