C17H22N2 — CID 20505336
4-ethyl-6-methyl-5,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2(7),3,12-tetraene (PubChem CID 20505336) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is 4-ethyl-6-methyl-5,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2(7),3,12-tetraene.
| Compound Name | 4-ethyl-6-methyl-5,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2(7),3,12-tetraene |
|---|---|
| PubChem CID | 20505336 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 4-ethyl-6-methyl-5,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2(7),3,12-tetraene |
| SMILES | CCC1=CC2=C(CC3CNC4=CCCC2=C43)C(C)N1 |
| InChI | InChI=1S/C17H22N2/c1-3-12-8-15-13-5-4-6-16-17(13)11(9-18-16)7-14(15)10(2)19-12/h6,8,10-11,18-19H,3-5,7,9H2,1-2H3 |
| InChIKey | CTCKBUBKVPLTPP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |