C14H16N2 — CID 20505355
5,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2(7),3,12-tetraene (PubChem CID 20505355) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is 5,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2(7),3,12-tetraene.
| Compound Name | 5,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2(7),3,12-tetraene |
|---|---|
| PubChem CID | 20505355 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 5,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2(7),3,12-tetraene |
| SMILES | C1=CC2=C(CN1)CC1CNC3=CCCC2=C31 |
| InChI | InChI=1S/C14H16N2/c1-2-12-11-4-5-15-7-9(11)6-10-8-16-13(3-1)14(10)12/h3-5,10,15-16H,1-2,6-8H2 |
| InChIKey | RDYZILRYAHMVPU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |