4-(azidomethyl)benzoic acid

C8H7N3O2 — CID 20505470

IUPAC4-(azidomethyl)benzoic acid
SMILES[N-]=[N+]=NCc1ccc(C(=O)O)cc1
InChIInChI=1S/C8H7N3O2/c9-11-10-5-6-1-3-7(4-2-6)8(12)13/h1-4H,5H2,(H,12,13)
InChIKeyQWRURNUFBGDSDL-UHFFFAOYSA-N
MW177.16 g/mol
LogP2.20
Rot. Bonds3

About 4-(azidomethyl)benzoic acid

4-(azidomethyl)benzoic acid (PubChem CID 20505470) has the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. Its IUPAC name is 4-(azidomethyl)benzoic acid.

Molecular Properties

Compound Name4-(azidomethyl)benzoic acid
PubChem CID20505470
Molecular FormulaC8H7N3O2
Molecular Weight177.16 g/mol
Exact Mass177.05
IUPAC Name4-(azidomethyl)benzoic acid
SMILES[N-]=[N+]=NCc1ccc(C(=O)O)cc1
InChIInChI=1S/C8H7N3O2/c9-11-10-5-6-1-3-7(4-2-6)8(12)13/h1-4H,5H2,(H,12,13)
InChIKeyQWRURNUFBGDSDL-UHFFFAOYSA-N
XLogP2.20
TPSA86.06 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500177.16
LogP ≤ 52.20
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}

Analyze 4-(azidomethyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(azidomethyl)benzoic acid?
The IUPAC name of 4-(azidomethyl)benzoic acid (CID 20505470) is 4-(azidomethyl)benzoic acid.
What is the SMILES notation for 4-(azidomethyl)benzoic acid?
The canonical SMILES for 4-(azidomethyl)benzoic acid is [N-]=[N+]=NCc1ccc(C(=O)O)cc1.
What is the InChIKey of 4-(azidomethyl)benzoic acid?
The InChIKey is QWRURNUFBGDSDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O2/c9-11-10-5-6-1-3-7(4-2-6)8(12)13/h1-4H,5H2,(H,12,13).
What are the key properties of 4-(azidomethyl)benzoic acid?
4-(azidomethyl)benzoic acid has a molecular weight of 177.16 g/mol, XLogP of 2.20, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(azidomethyl)benzoic acid is sourced from PubChem (CID 20505470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).