About 4-(azidomethyl)benzoic acid
4-(azidomethyl)benzoic acid (PubChem CID 20505470) has the molecular formula C8H7N3O2
and a molecular weight of 177.16 g/mol. Its IUPAC name is 4-(azidomethyl)benzoic acid.
Molecular Properties
| Compound Name | 4-(azidomethyl)benzoic acid |
| PubChem CID | 20505470 |
| Molecular Formula | C8H7N3O2 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | 4-(azidomethyl)benzoic acid |
| SMILES | [N-]=[N+]=NCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C8H7N3O2/c9-11-10-5-6-1-3-7(4-2-6)8(12)13/h1-4H,5H2,(H,12,13) |
| InChIKey | QWRURNUFBGDSDL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 86.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-(azidomethyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(azidomethyl)benzoic acid?
The IUPAC name of 4-(azidomethyl)benzoic acid (CID 20505470) is 4-(azidomethyl)benzoic acid.
What is the SMILES notation for 4-(azidomethyl)benzoic acid?
The canonical SMILES for 4-(azidomethyl)benzoic acid is [N-]=[N+]=NCc1ccc(C(=O)O)cc1.
What is the InChIKey of 4-(azidomethyl)benzoic acid?
The InChIKey is QWRURNUFBGDSDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O2/c9-11-10-5-6-1-3-7(4-2-6)8(12)13/h1-4H,5H2,(H,12,13).
What are the key properties of 4-(azidomethyl)benzoic acid?
4-(azidomethyl)benzoic acid has a molecular weight of 177.16 g/mol, XLogP of 2.20, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(azidomethyl)benzoic acid is sourced from PubChem (CID 20505470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).