About 4-azidopentanenitrile
4-azidopentanenitrile (PubChem CID 20505518) has the molecular formula C5H8N4
and a molecular weight of 124.15 g/mol. Its IUPAC name is 4-azidopentanenitrile.
Molecular Properties
| Compound Name | 4-azidopentanenitrile |
| PubChem CID | 20505518 |
| Molecular Formula | C5H8N4 |
| Molecular Weight | 124.15 g/mol |
| Exact Mass | 124.07 |
| IUPAC Name | 4-azidopentanenitrile |
| SMILES | CC(CCC#N)N=[N+]=[N-] |
| InChI | InChI=1S/C5H8N4/c1-5(8-9-7)3-2-4-6/h5H,2-3H2,1H3 |
| InChIKey | ZJBIYSDMVWXBDS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 72.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.15 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-azidopentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azidopentanenitrile?
The IUPAC name of 4-azidopentanenitrile (CID 20505518) is 4-azidopentanenitrile.
What is the SMILES notation for 4-azidopentanenitrile?
The canonical SMILES for 4-azidopentanenitrile is CC(CCC#N)N=[N+]=[N-].
What is the InChIKey of 4-azidopentanenitrile?
The InChIKey is ZJBIYSDMVWXBDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4/c1-5(8-9-7)3-2-4-6/h5H,2-3H2,1H3.
What are the key properties of 4-azidopentanenitrile?
4-azidopentanenitrile has a molecular weight of 124.15 g/mol, XLogP of 1.99, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azidopentanenitrile is sourced from PubChem (CID 20505518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).