C18H15BrFN3O3 — CID 20506194
9-bromo-5-(2-fluorophenyl)-1,3,3-trimethyl-7-nitro-1,4-benzodiazepin-2-one (PubChem CID 20506194) has the molecular formula C18H15BrFN3O3 and a molecular weight of 420.24 g/mol. Its IUPAC name is 9-bromo-5-(2-fluorophenyl)-1,3,3-trimethyl-7-nitro-1,4-benzodiazepin-2-one.
| Compound Name | 9-bromo-5-(2-fluorophenyl)-1,3,3-trimethyl-7-nitro-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 20506194 |
| Molecular Formula | C18H15BrFN3O3 |
| Molecular Weight | 420.24 g/mol |
| Exact Mass | 419.03 |
| IUPAC Name | 9-bromo-5-(2-fluorophenyl)-1,3,3-trimethyl-7-nitro-1,4-benzodiazepin-2-one |
| SMILES | CN1C(=O)C(C)(C)N=C(c2ccccc2F)c2cc([N+](=O)[O-])cc(Br)c21 |
| InChI | InChI=1S/C18H15BrFN3O3/c1-18(2)17(24)22(3)16-12(8-10(23(25)26)9-13(16)19)15(21-18)11-6-4-5-7-14(11)20/h4-9H,1-3H3 |
| InChIKey | SPGXUMDGQBRLDJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.24 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|