C13H18N4O5S — CID 20506816
3-(3-azidopropylsulfinylmethyl)-6-(1-hydroxyethyl)-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 20506816) has the molecular formula C13H18N4O5S and a molecular weight of 342.38 g/mol. Its IUPAC name is 3-(3-azidopropylsulfinylmethyl)-6-(1-hydroxyethyl)-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | 3-(3-azidopropylsulfinylmethyl)-6-(1-hydroxyethyl)-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 20506816 |
| Molecular Formula | C13H18N4O5S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 3-(3-azidopropylsulfinylmethyl)-6-(1-hydroxyethyl)-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | CC(O)C1C(=O)N2C(C(=O)O)=C(CS(=O)CCCN=[N+]=[N-])CC12 |
| InChI | InChI=1S/C13H18N4O5S/c1-7(18)10-9-5-8(6-23(22)4-2-3-15-16-14)11(13(20)21)17(9)12(10)19/h7,9-10,18H,2-6H2,1H3,(H,20,21) |
| InChIKey | FVDHGZDNFUTPOP-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 143.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|