About 1-chloroethyl 2-cyanoaziridine-1-carboxylate
1-chloroethyl 2-cyanoaziridine-1-carboxylate (PubChem CID 20507097) has the molecular formula C6H7ClN2O2
and a molecular weight of 174.59 g/mol. Its IUPAC name is 1-chloroethyl 2-cyanoaziridine-1-carboxylate.
Molecular Properties
| Compound Name | 1-chloroethyl 2-cyanoaziridine-1-carboxylate |
| PubChem CID | 20507097 |
| Molecular Formula | C6H7ClN2O2 |
| Molecular Weight | 174.59 g/mol |
| Exact Mass | 174.02 |
| IUPAC Name | 1-chloroethyl 2-cyanoaziridine-1-carboxylate |
| SMILES | CC(Cl)OC(=O)N1CC1C#N |
| InChI | InChI=1S/C6H7ClN2O2/c1-4(7)11-6(10)9-3-5(9)2-8/h4-5H,3H2,1H3 |
| InChIKey | LORNEUXUUWHVTQ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 53.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.59 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-chloroethyl 2-cyanoaziridine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloroethyl 2-cyanoaziridine-1-carboxylate?
The IUPAC name of 1-chloroethyl 2-cyanoaziridine-1-carboxylate (CID 20507097) is 1-chloroethyl 2-cyanoaziridine-1-carboxylate.
What is the SMILES notation for 1-chloroethyl 2-cyanoaziridine-1-carboxylate?
The canonical SMILES for 1-chloroethyl 2-cyanoaziridine-1-carboxylate is CC(Cl)OC(=O)N1CC1C#N.
What is the InChIKey of 1-chloroethyl 2-cyanoaziridine-1-carboxylate?
The InChIKey is LORNEUXUUWHVTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClN2O2/c1-4(7)11-6(10)9-3-5(9)2-8/h4-5H,3H2,1H3.
What are the key properties of 1-chloroethyl 2-cyanoaziridine-1-carboxylate?
1-chloroethyl 2-cyanoaziridine-1-carboxylate has a molecular weight of 174.59 g/mol, XLogP of 0.92, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloroethyl 2-cyanoaziridine-1-carboxylate is sourced from PubChem (CID 20507097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).