About 8-piperazin-1-ylimidazo[1,2-a]pyrazine;hydrate;dihydrochloride
8-piperazin-1-ylimidazo[1,2-a]pyrazine;hydrate;dihydrochloride (PubChem CID 20507204) has the molecular formula C10H17Cl2N5O
and a molecular weight of 294.19 g/mol. Its IUPAC name is 8-piperazin-1-ylimidazo[1,2-a]pyrazine;hydrate;dihydrochloride.
Molecular Properties
| Compound Name | 8-piperazin-1-ylimidazo[1,2-a]pyrazine;hydrate;dihydrochloride |
| PubChem CID | 20507204 |
| Molecular Formula | C10H17Cl2N5O |
| Molecular Weight | 294.19 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 8-piperazin-1-ylimidazo[1,2-a]pyrazine;hydrate;dihydrochloride |
| SMILES | Cl.Cl.O.c1cn2ccnc2c(N2CCNCC2)n1 |
| InChI | InChI=1S/C10H13N5.2ClH.H2O/c1-5-14(6-2-11-1)9-10-13-4-8-15(10)7-3-12-9;;;/h3-4,7-8,11H,1-2,5-6H2;2*1H;1H2 |
| InChIKey | NRNIMZYGVVGQMV-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.19 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-piperazin-1-ylimidazo[1,2-a]pyrazine;hydrate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-piperazin-1-ylimidazo[1,2-a]pyrazine;hydrate;dihydrochloride?
The IUPAC name of 8-piperazin-1-ylimidazo[1,2-a]pyrazine;hydrate;dihydrochloride (CID 20507204) is 8-piperazin-1-ylimidazo[1,2-a]pyrazine;hydrate;dihydrochloride.
What is the SMILES notation for 8-piperazin-1-ylimidazo[1,2-a]pyrazine;hydrate;dihydrochloride?
The canonical SMILES for 8-piperazin-1-ylimidazo[1,2-a]pyrazine;hydrate;dihydrochloride is Cl.Cl.O.c1cn2ccnc2c(N2CCNCC2)n1.
What is the InChIKey of 8-piperazin-1-ylimidazo[1,2-a]pyrazine;hydrate;dihydrochloride?
The InChIKey is NRNIMZYGVVGQMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N5.2ClH.H2O/c1-5-14(6-2-11-1)9-10-13-4-8-15(10)7-3-12-9;;;/h3-4,7-8,11H,1-2,5-6H2;2*1H;1H2.
What are the key properties of 8-piperazin-1-ylimidazo[1,2-a]pyrazine;hydrate;dihydrochloride?
8-piperazin-1-ylimidazo[1,2-a]pyrazine;hydrate;dihydrochloride has a molecular weight of 294.19 g/mol, XLogP of 0.16, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-piperazin-1-ylimidazo[1,2-a]pyrazine;hydrate;dihydrochloride is sourced from PubChem (CID 20507204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).