C10H14Br2 — CID 20507679
3,6-dibromo-1,3,4,6-tetramethylcyclohexa-1,4-diene (PubChem CID 20507679) has the molecular formula C10H14Br2 and a molecular weight of 294.03 g/mol. Its IUPAC name is 3,6-dibromo-1,3,4,6-tetramethylcyclohexa-1,4-diene.
| Compound Name | 3,6-dibromo-1,3,4,6-tetramethylcyclohexa-1,4-diene |
|---|---|
| PubChem CID | 20507679 |
| Molecular Formula | C10H14Br2 |
| Molecular Weight | 294.03 g/mol |
| Exact Mass | 291.95 |
| IUPAC Name | 3,6-dibromo-1,3,4,6-tetramethylcyclohexa-1,4-diene |
| SMILES | CC1=CC(C)(Br)C(C)=CC1(C)Br |
| InChI | InChI=1S/C10H14Br2/c1-7-5-10(4,12)8(2)6-9(7,3)11/h5-6H,1-4H3 |
| InChIKey | QAMCRNSBSDHEPN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.03 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|