About 3-(2-aminopropanoylamino)-4,4-difluorobutanoic acid
3-(2-aminopropanoylamino)-4,4-difluorobutanoic acid (PubChem CID 20508354) has the molecular formula C7H12F2N2O3
and a molecular weight of 210.18 g/mol. Its IUPAC name is 3-(2-aminopropanoylamino)-4,4-difluorobutanoic acid.
Molecular Properties
| Compound Name | 3-(2-aminopropanoylamino)-4,4-difluorobutanoic acid |
| PubChem CID | 20508354 |
| Molecular Formula | C7H12F2N2O3 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 3-(2-aminopropanoylamino)-4,4-difluorobutanoic acid |
| SMILES | CC(N)C(=O)NC(CC(=O)O)C(F)F |
| InChI | InChI=1S/C7H12F2N2O3/c1-3(10)7(14)11-4(6(8)9)2-5(12)13/h3-4,6H,2,10H2,1H3,(H,11,14)(H,12,13) |
| InChIKey | OEYFUZKNZIZDGQ-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-aminopropanoylamino)-4,4-difluorobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-aminopropanoylamino)-4,4-difluorobutanoic acid?
The IUPAC name of 3-(2-aminopropanoylamino)-4,4-difluorobutanoic acid (CID 20508354) is 3-(2-aminopropanoylamino)-4,4-difluorobutanoic acid.
What is the SMILES notation for 3-(2-aminopropanoylamino)-4,4-difluorobutanoic acid?
The canonical SMILES for 3-(2-aminopropanoylamino)-4,4-difluorobutanoic acid is CC(N)C(=O)NC(CC(=O)O)C(F)F.
What is the InChIKey of 3-(2-aminopropanoylamino)-4,4-difluorobutanoic acid?
The InChIKey is OEYFUZKNZIZDGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12F2N2O3/c1-3(10)7(14)11-4(6(8)9)2-5(12)13/h3-4,6H,2,10H2,1H3,(H,11,14)(H,12,13).
What are the key properties of 3-(2-aminopropanoylamino)-4,4-difluorobutanoic acid?
3-(2-aminopropanoylamino)-4,4-difluorobutanoic acid has a molecular weight of 210.18 g/mol, XLogP of -0.44, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-aminopropanoylamino)-4,4-difluorobutanoic acid is sourced from PubChem (CID 20508354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).