About butane;butan-2-one
butane;butan-2-one (PubChem CID 20508385) has the molecular formula C8H18O
and a molecular weight of 130.23 g/mol. Its IUPAC name is butane;butan-2-one.
Molecular Properties
| Compound Name | butane;butan-2-one |
| PubChem CID | 20508385 |
| Molecular Formula | C8H18O |
| Molecular Weight | 130.23 g/mol |
| Exact Mass | 130.14 |
| IUPAC Name | butane;butan-2-one |
| SMILES | CCC(C)=O.CCCC |
| InChI | InChI=1S/C4H8O.C4H10/c1-3-4(2)5;1-3-4-2/h3H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | HNQNFERVOAVLIQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.23 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze butane;butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;butan-2-one?
The IUPAC name of butane;butan-2-one (CID 20508385) is butane;butan-2-one.
What is the SMILES notation for butane;butan-2-one?
The canonical SMILES for butane;butan-2-one is CCC(C)=O.CCCC.
What is the InChIKey of butane;butan-2-one?
The InChIKey is HNQNFERVOAVLIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.C4H10/c1-3-4(2)5;1-3-4-2/h3H2,1-2H3;3-4H2,1-2H3.
What are the key properties of butane;butan-2-one?
butane;butan-2-one has a molecular weight of 130.23 g/mol, XLogP of 2.79, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butane;butan-2-one is sourced from PubChem (CID 20508385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).