C23H34O3S — CID 20509039
2-methyl-3,4,5,6-tetra(propan-2-yl)naphthalene-1-sulfonic acid (PubChem CID 20509039) has the molecular formula C23H34O3S and a molecular weight of 390.59 g/mol. Its IUPAC name is 2-methyl-3,4,5,6-tetra(propan-2-yl)naphthalene-1-sulfonic acid.
| Compound Name | 2-methyl-3,4,5,6-tetra(propan-2-yl)naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 20509039 |
| Molecular Formula | C23H34O3S |
| Molecular Weight | 390.59 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 2-methyl-3,4,5,6-tetra(propan-2-yl)naphthalene-1-sulfonic acid |
| SMILES | Cc1c(C(C)C)c(C(C)C)c2c(C(C)C)c(C(C)C)ccc2c1S(=O)(=O)O |
| InChI | InChI=1S/C23H34O3S/c1-12(2)17-10-11-18-22(20(17)14(5)6)21(15(7)8)19(13(3)4)16(9)23(18)27(24,25)26/h10-15H,1-9H3,(H,24,25,26) |
| InChIKey | ODXHNZFWFYKHGS-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.59 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|