C9H10F3N5O4 — CID 20509642
1-N,1-N-dimethyl-2,4-dinitro-6-(trifluoromethyl)benzene-1,3,5-triamine (PubChem CID 20509642) has the molecular formula C9H10F3N5O4 and a molecular weight of 309.20 g/mol. Its IUPAC name is 1-N,1-N-dimethyl-2,4-dinitro-6-(trifluoromethyl)benzene-1,3,5-triamine.
| Compound Name | 1-N,1-N-dimethyl-2,4-dinitro-6-(trifluoromethyl)benzene-1,3,5-triamine |
|---|---|
| PubChem CID | 20509642 |
| Molecular Formula | C9H10F3N5O4 |
| Molecular Weight | 309.20 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 1-N,1-N-dimethyl-2,4-dinitro-6-(trifluoromethyl)benzene-1,3,5-triamine |
| SMILES | CN(C)c1c([N+](=O)[O-])c(N)c([N+](=O)[O-])c(N)c1C(F)(F)F |
| InChI | InChI=1S/C9H10F3N5O4/c1-15(2)6-3(9(10,11)12)4(13)7(16(18)19)5(14)8(6)17(20)21/h13-14H2,1-2H3 |
| InChIKey | HHECGAJSDJLHIO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 141.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.20 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|