About 7-chloro-5,10-dihydroimidazo[2,1-b]quinazoline
7-chloro-5,10-dihydroimidazo[2,1-b]quinazoline (PubChem CID 20509916) has the molecular formula C10H8ClN3
and a molecular weight of 205.65 g/mol. Its IUPAC name is 7-chloro-5,10-dihydroimidazo[2,1-b]quinazoline.
Molecular Properties
| Compound Name | 7-chloro-5,10-dihydroimidazo[2,1-b]quinazoline |
| PubChem CID | 20509916 |
| Molecular Formula | C10H8ClN3 |
| Molecular Weight | 205.65 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | 7-chloro-5,10-dihydroimidazo[2,1-b]quinazoline |
| SMILES | Clc1ccc2c(c1)Cn1ccnc1N2 |
| InChI | InChI=1S/C10H8ClN3/c11-8-1-2-9-7(5-8)6-14-4-3-12-10(14)13-9/h1-5H,6H2,(H,12,13) |
| InChIKey | GUKZIMNYATXFPS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.65 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-chloro-5,10-dihydroimidazo[2,1-b]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-5,10-dihydroimidazo[2,1-b]quinazoline?
The IUPAC name of 7-chloro-5,10-dihydroimidazo[2,1-b]quinazoline (CID 20509916) is 7-chloro-5,10-dihydroimidazo[2,1-b]quinazoline.
What is the SMILES notation for 7-chloro-5,10-dihydroimidazo[2,1-b]quinazoline?
The canonical SMILES for 7-chloro-5,10-dihydroimidazo[2,1-b]quinazoline is Clc1ccc2c(c1)Cn1ccnc1N2.
What is the InChIKey of 7-chloro-5,10-dihydroimidazo[2,1-b]quinazoline?
The InChIKey is GUKZIMNYATXFPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8ClN3/c11-8-1-2-9-7(5-8)6-14-4-3-12-10(14)13-9/h1-5H,6H2,(H,12,13).
What are the key properties of 7-chloro-5,10-dihydroimidazo[2,1-b]quinazoline?
7-chloro-5,10-dihydroimidazo[2,1-b]quinazoline has a molecular weight of 205.65 g/mol, XLogP of 2.64, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-5,10-dihydroimidazo[2,1-b]quinazoline is sourced from PubChem (CID 20509916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).