About methyl N'-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]carbamimidothioate
methyl N'-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]carbamimidothioate (PubChem CID 20509961) has the molecular formula C8H13N3OS2
and a molecular weight of 231.35 g/mol. Its IUPAC name is methyl N'-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]carbamimidothioate.
Molecular Properties
| Compound Name | methyl N'-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]carbamimidothioate |
| PubChem CID | 20509961 |
| Molecular Formula | C8H13N3OS2 |
| Molecular Weight | 231.35 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | methyl N'-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]carbamimidothioate |
| SMILES | CS/C(N)=N\CCSCc1ccon1 |
| InChI | InChI=1S/C8H13N3OS2/c1-13-8(9)10-3-5-14-6-7-2-4-12-11-7/h2,4H,3,5-6H2,1H3,(H2,9,10) |
| InChIKey | NRHAXWOJFMODNA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 64.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N'-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N'-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]carbamimidothioate?
The IUPAC name of methyl N'-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]carbamimidothioate (CID 20509961) is methyl N'-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]carbamimidothioate.
What is the SMILES notation for methyl N'-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]carbamimidothioate?
The canonical SMILES for methyl N'-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]carbamimidothioate is CS/C(N)=N\CCSCc1ccon1.
What is the InChIKey of methyl N'-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]carbamimidothioate?
The InChIKey is NRHAXWOJFMODNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3OS2/c1-13-8(9)10-3-5-14-6-7-2-4-12-11-7/h2,4H,3,5-6H2,1H3,(H2,9,10).
What are the key properties of methyl N'-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]carbamimidothioate?
methyl N'-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]carbamimidothioate has a molecular weight of 231.35 g/mol, XLogP of 1.59, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N'-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]carbamimidothioate is sourced from PubChem (CID 20509961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).