About 2-[3,5-dihydroxy-2-(3-hydroxyoctyl)cyclopentyl]acetaldehyde
2-[3,5-dihydroxy-2-(3-hydroxyoctyl)cyclopentyl]acetaldehyde (PubChem CID 20510047) has the molecular formula C15H28O4
and a molecular weight of 272.38 g/mol. Its IUPAC name is 2-[3,5-dihydroxy-2-(3-hydroxyoctyl)cyclopentyl]acetaldehyde.
Molecular Properties
| Compound Name | 2-[3,5-dihydroxy-2-(3-hydroxyoctyl)cyclopentyl]acetaldehyde |
| PubChem CID | 20510047 |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | 2-[3,5-dihydroxy-2-(3-hydroxyoctyl)cyclopentyl]acetaldehyde |
| SMILES | CCCCCC(O)CCC1C(O)CC(O)C1CC=O |
| InChI | InChI=1S/C15H28O4/c1-2-3-4-5-11(17)6-7-12-13(8-9-16)15(19)10-14(12)18/h9,11-15,17-19H,2-8,10H2,1H3 |
| InChIKey | AQZORCDOABTBKW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[3,5-dihydroxy-2-(3-hydroxyoctyl)cyclopentyl]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-dihydroxy-2-(3-hydroxyoctyl)cyclopentyl]acetaldehyde?
The IUPAC name of 2-[3,5-dihydroxy-2-(3-hydroxyoctyl)cyclopentyl]acetaldehyde (CID 20510047) is 2-[3,5-dihydroxy-2-(3-hydroxyoctyl)cyclopentyl]acetaldehyde.
What is the SMILES notation for 2-[3,5-dihydroxy-2-(3-hydroxyoctyl)cyclopentyl]acetaldehyde?
The canonical SMILES for 2-[3,5-dihydroxy-2-(3-hydroxyoctyl)cyclopentyl]acetaldehyde is CCCCCC(O)CCC1C(O)CC(O)C1CC=O.
What is the InChIKey of 2-[3,5-dihydroxy-2-(3-hydroxyoctyl)cyclopentyl]acetaldehyde?
The InChIKey is AQZORCDOABTBKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O4/c1-2-3-4-5-11(17)6-7-12-13(8-9-16)15(19)10-14(12)18/h9,11-15,17-19H,2-8,10H2,1H3.
What are the key properties of 2-[3,5-dihydroxy-2-(3-hydroxyoctyl)cyclopentyl]acetaldehyde?
2-[3,5-dihydroxy-2-(3-hydroxyoctyl)cyclopentyl]acetaldehyde has a molecular weight of 272.38 g/mol, XLogP of 1.65, 9 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-dihydroxy-2-(3-hydroxyoctyl)cyclopentyl]acetaldehyde is sourced from PubChem (CID 20510047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).