About 3-aminobutyl acetate
3-aminobutyl acetate (PubChem CID 20510069) has the molecular formula C6H13NO2
and a molecular weight of 131.18 g/mol. Its IUPAC name is 3-aminobutyl acetate.
Molecular Properties
| Compound Name | 3-aminobutyl acetate |
| PubChem CID | 20510069 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | 3-aminobutyl acetate |
| SMILES | CC(=O)OCCC(C)N |
| InChI | InChI=1S/C6H13NO2/c1-5(7)3-4-9-6(2)8/h5H,3-4,7H2,1-2H3 |
| InChIKey | QLIABFUCGAPTLK-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-aminobutyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminobutyl acetate?
The IUPAC name of 3-aminobutyl acetate (CID 20510069) is 3-aminobutyl acetate.
What is the SMILES notation for 3-aminobutyl acetate?
The canonical SMILES for 3-aminobutyl acetate is CC(=O)OCCC(C)N.
What is the InChIKey of 3-aminobutyl acetate?
The InChIKey is QLIABFUCGAPTLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO2/c1-5(7)3-4-9-6(2)8/h5H,3-4,7H2,1-2H3.
What are the key properties of 3-aminobutyl acetate?
3-aminobutyl acetate has a molecular weight of 131.18 g/mol, XLogP of 0.29, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminobutyl acetate is sourced from PubChem (CID 20510069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).