About 2-formyl-4,6-dimethylbenzene-1,3,5-tricarbonitrile
2-formyl-4,6-dimethylbenzene-1,3,5-tricarbonitrile (PubChem CID 20510505) has the molecular formula C12H7N3O
and a molecular weight of 209.21 g/mol. Its IUPAC name is 2-formyl-4,6-dimethylbenzene-1,3,5-tricarbonitrile.
Molecular Properties
| Compound Name | 2-formyl-4,6-dimethylbenzene-1,3,5-tricarbonitrile |
| PubChem CID | 20510505 |
| Molecular Formula | C12H7N3O |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 2-formyl-4,6-dimethylbenzene-1,3,5-tricarbonitrile |
| SMILES | Cc1c(C#N)c(C)c(C#N)c(C=O)c1C#N |
| InChI | InChI=1S/C12H7N3O/c1-7-9(3-13)8(2)11(5-15)12(6-16)10(7)4-14/h6H,1-2H3 |
| InChIKey | BIUIUELHPCHABT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 88.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-formyl-4,6-dimethylbenzene-1,3,5-tricarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-formyl-4,6-dimethylbenzene-1,3,5-tricarbonitrile?
The IUPAC name of 2-formyl-4,6-dimethylbenzene-1,3,5-tricarbonitrile (CID 20510505) is 2-formyl-4,6-dimethylbenzene-1,3,5-tricarbonitrile.
What is the SMILES notation for 2-formyl-4,6-dimethylbenzene-1,3,5-tricarbonitrile?
The canonical SMILES for 2-formyl-4,6-dimethylbenzene-1,3,5-tricarbonitrile is Cc1c(C#N)c(C)c(C#N)c(C=O)c1C#N.
What is the InChIKey of 2-formyl-4,6-dimethylbenzene-1,3,5-tricarbonitrile?
The InChIKey is BIUIUELHPCHABT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7N3O/c1-7-9(3-13)8(2)11(5-15)12(6-16)10(7)4-14/h6H,1-2H3.
What are the key properties of 2-formyl-4,6-dimethylbenzene-1,3,5-tricarbonitrile?
2-formyl-4,6-dimethylbenzene-1,3,5-tricarbonitrile has a molecular weight of 209.21 g/mol, XLogP of 1.73, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-formyl-4,6-dimethylbenzene-1,3,5-tricarbonitrile is sourced from PubChem (CID 20510505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).