C9H9F7O3S — CID 20510803
methyl 3,3,4,4,5,5,5-heptafluoro-2-(2-methylsulfanyl-2-oxoethyl)pentanoate (PubChem CID 20510803) has the molecular formula C9H9F7O3S and a molecular weight of 330.22 g/mol. Its IUPAC name is methyl 3,3,4,4,5,5,5-heptafluoro-2-(2-methylsulfanyl-2-oxoethyl)pentanoate.
| Compound Name | methyl 3,3,4,4,5,5,5-heptafluoro-2-(2-methylsulfanyl-2-oxoethyl)pentanoate |
|---|---|
| PubChem CID | 20510803 |
| Molecular Formula | C9H9F7O3S |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | methyl 3,3,4,4,5,5,5-heptafluoro-2-(2-methylsulfanyl-2-oxoethyl)pentanoate |
| SMILES | COC(=O)C(CC(=O)SC)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H9F7O3S/c1-19-6(18)4(3-5(17)20-2)7(10,11)8(12,13)9(14,15)16/h4H,3H2,1-2H3 |
| InChIKey | KGLMZLOHSZZGDE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|