About 2-(2,2-diethoxyethyl)-1,3,4-thiadiazole
2-(2,2-diethoxyethyl)-1,3,4-thiadiazole (PubChem CID 20511280) has the molecular formula C8H14N2O2S
and a molecular weight of 202.28 g/mol. Its IUPAC name is 2-(2,2-diethoxyethyl)-1,3,4-thiadiazole.
Molecular Properties
| Compound Name | 2-(2,2-diethoxyethyl)-1,3,4-thiadiazole |
| PubChem CID | 20511280 |
| Molecular Formula | C8H14N2O2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 2-(2,2-diethoxyethyl)-1,3,4-thiadiazole |
| SMILES | CCOC(Cc1nncs1)OCC |
| InChI | InChI=1S/C8H14N2O2S/c1-3-11-8(12-4-2)5-7-10-9-6-13-7/h6,8H,3-5H2,1-2H3 |
| InChIKey | JOEQRFHRYROCCO-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-diethoxyethyl)-1,3,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-diethoxyethyl)-1,3,4-thiadiazole?
The IUPAC name of 2-(2,2-diethoxyethyl)-1,3,4-thiadiazole (CID 20511280) is 2-(2,2-diethoxyethyl)-1,3,4-thiadiazole.
What is the SMILES notation for 2-(2,2-diethoxyethyl)-1,3,4-thiadiazole?
The canonical SMILES for 2-(2,2-diethoxyethyl)-1,3,4-thiadiazole is CCOC(Cc1nncs1)OCC.
What is the InChIKey of 2-(2,2-diethoxyethyl)-1,3,4-thiadiazole?
The InChIKey is JOEQRFHRYROCCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2S/c1-3-11-8(12-4-2)5-7-10-9-6-13-7/h6,8H,3-5H2,1-2H3.
What are the key properties of 2-(2,2-diethoxyethyl)-1,3,4-thiadiazole?
2-(2,2-diethoxyethyl)-1,3,4-thiadiazole has a molecular weight of 202.28 g/mol, XLogP of 1.48, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-diethoxyethyl)-1,3,4-thiadiazole is sourced from PubChem (CID 20511280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).