C18H26N2 — CID 20511355
N,N-dipropyl-4,5,6,7-tetrahydro-1H-benzo[e]indol-5-amine (PubChem CID 20511355) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is N,N-dipropyl-4,5,6,7-tetrahydro-1H-benzo[e]indol-5-amine.
| Compound Name | N,N-dipropyl-4,5,6,7-tetrahydro-1H-benzo[e]indol-5-amine |
|---|---|
| PubChem CID | 20511355 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | N,N-dipropyl-4,5,6,7-tetrahydro-1H-benzo[e]indol-5-amine |
| SMILES | CCCN(CCC)C1CC2=C(CC=N2)C2=C1CCC=C2 |
| InChI | InChI=1S/C18H26N2/c1-3-11-20(12-4-2)18-13-17-15(9-10-19-17)14-7-5-6-8-16(14)18/h5,7,10,18H,3-4,6,8-9,11-13H2,1-2H3 |
| InChIKey | LFSAIBSEOOJZRI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |