C30H58O2S2 — CID 20511489
1,3-bis(2-methylundecan-2-ylsulfanyl)propan-2-yl prop-2-enoate (PubChem CID 20511489) has the molecular formula C30H58O2S2 and a molecular weight of 514.93 g/mol. Its IUPAC name is 1,3-bis(2-methylundecan-2-ylsulfanyl)propan-2-yl prop-2-enoate.
| Compound Name | 1,3-bis(2-methylundecan-2-ylsulfanyl)propan-2-yl prop-2-enoate |
|---|---|
| PubChem CID | 20511489 |
| Molecular Formula | C30H58O2S2 |
| Molecular Weight | 514.93 g/mol |
| Exact Mass | 514.39 |
| IUPAC Name | 1,3-bis(2-methylundecan-2-ylsulfanyl)propan-2-yl prop-2-enoate |
| SMILES | C=CC(=O)OC(CSC(C)(C)CCCCCCCCC)CSC(C)(C)CCCCCCCCC |
| InChI | InChI=1S/C30H58O2S2/c1-8-11-13-15-17-19-21-23-29(4,5)33-25-27(32-28(31)10-3)26-34-30(6,7)24-22-20-18-16-14-12-9-2/h10,27H,3,8-9,11-26H2,1-2,4-7H3 |
| InChIKey | OHWYWCODJHVTCS-UHFFFAOYSA-N |
| XLogP | 10.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.93 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|