About 2-pyrrolidin-1-ylethyl 4-phenylpiperidine-4-carboxylate
2-pyrrolidin-1-ylethyl 4-phenylpiperidine-4-carboxylate (PubChem CID 20511851) has the molecular formula C18H26N2O2
and a molecular weight of 302.42 g/mol. Its IUPAC name is 2-pyrrolidin-1-ylethyl 4-phenylpiperidine-4-carboxylate.
Molecular Properties
| Compound Name | 2-pyrrolidin-1-ylethyl 4-phenylpiperidine-4-carboxylate |
| PubChem CID | 20511851 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 2-pyrrolidin-1-ylethyl 4-phenylpiperidine-4-carboxylate |
| SMILES | O=C(OCCN1CCCC1)C1(c2ccccc2)CCNCC1 |
| InChI | InChI=1S/C18H26N2O2/c21-17(22-15-14-20-12-4-5-13-20)18(8-10-19-11-9-18)16-6-2-1-3-7-16/h1-3,6-7,19H,4-5,8-15H2 |
| InChIKey | LZOYQOUKCPFNFO-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-pyrrolidin-1-ylethyl 4-phenylpiperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrrolidin-1-ylethyl 4-phenylpiperidine-4-carboxylate?
The IUPAC name of 2-pyrrolidin-1-ylethyl 4-phenylpiperidine-4-carboxylate (CID 20511851) is 2-pyrrolidin-1-ylethyl 4-phenylpiperidine-4-carboxylate.
What is the SMILES notation for 2-pyrrolidin-1-ylethyl 4-phenylpiperidine-4-carboxylate?
The canonical SMILES for 2-pyrrolidin-1-ylethyl 4-phenylpiperidine-4-carboxylate is O=C(OCCN1CCCC1)C1(c2ccccc2)CCNCC1.
What is the InChIKey of 2-pyrrolidin-1-ylethyl 4-phenylpiperidine-4-carboxylate?
The InChIKey is LZOYQOUKCPFNFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2O2/c21-17(22-15-14-20-12-4-5-13-20)18(8-10-19-11-9-18)16-6-2-1-3-7-16/h1-3,6-7,19H,4-5,8-15H2.
What are the key properties of 2-pyrrolidin-1-ylethyl 4-phenylpiperidine-4-carboxylate?
2-pyrrolidin-1-ylethyl 4-phenylpiperidine-4-carboxylate has a molecular weight of 302.42 g/mol, XLogP of 1.95, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrrolidin-1-ylethyl 4-phenylpiperidine-4-carboxylate is sourced from PubChem (CID 20511851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).