About 1-benzofuran;oxaldehydic acid
1-benzofuran;oxaldehydic acid (PubChem CID 20511979) has the molecular formula C10H8O4
and a molecular weight of 192.17 g/mol. Its IUPAC name is 1-benzofuran;oxaldehydic acid.
Molecular Properties
| Compound Name | 1-benzofuran;oxaldehydic acid |
| PubChem CID | 20511979 |
| Molecular Formula | C10H8O4 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 1-benzofuran;oxaldehydic acid |
| SMILES | O=CC(=O)O.c1ccc2occc2c1 |
| InChI | InChI=1S/C8H6O.C2H2O3/c1-2-4-8-7(3-1)5-6-9-8;3-1-2(4)5/h1-6H;1H,(H,4,5) |
| InChIKey | ANXNCTCTSPVYIS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-benzofuran;oxaldehydic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzofuran;oxaldehydic acid?
The IUPAC name of 1-benzofuran;oxaldehydic acid (CID 20511979) is 1-benzofuran;oxaldehydic acid.
What is the SMILES notation for 1-benzofuran;oxaldehydic acid?
The canonical SMILES for 1-benzofuran;oxaldehydic acid is O=CC(=O)O.c1ccc2occc2c1.
What is the InChIKey of 1-benzofuran;oxaldehydic acid?
The InChIKey is ANXNCTCTSPVYIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O.C2H2O3/c1-2-4-8-7(3-1)5-6-9-8;3-1-2(4)5/h1-6H;1H,(H,4,5).
What are the key properties of 1-benzofuran;oxaldehydic acid?
1-benzofuran;oxaldehydic acid has a molecular weight of 192.17 g/mol, XLogP of 1.70, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzofuran;oxaldehydic acid is sourced from PubChem (CID 20511979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).