C24H32N6O6 — CID 20511981
1-[2-[3,5-bis[(E)-but-2-enyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl]-3,5-bis[(E)-but-2-enyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 20511981) has the molecular formula C24H32N6O6 and a molecular weight of 500.56 g/mol. Its IUPAC name is 1-[2-[3,5-bis[(E)-but-2-enyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl]-3,5-bis[(E)-but-2-enyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-[2-[3,5-bis[(E)-but-2-enyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl]-3,5-bis[(E)-but-2-enyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 20511981 |
| Molecular Formula | C24H32N6O6 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | 1-[2-[3,5-bis[(E)-but-2-enyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl]-3,5-bis[(E)-but-2-enyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | C/C=C/Cn1c(=O)n(C/C=C/C)c(=O)n(CCn2c(=O)n(C/C=C/C)c(=O)n(C/C=C/C)c2=O)c1=O |
| InChI | InChI=1S/C24H32N6O6/c1-5-9-13-25-19(31)26(14-10-6-2)22(34)29(21(25)33)17-18-30-23(35)27(15-11-7-3)20(32)28(24(30)36)16-12-8-4/h5-12H,13-18H2,1-4H3/b9-5+,10-6+,11-7+,12-8+ |
| InChIKey | IMPRWRJHTIXIRS-HFBXSBKTSA-N |
| XLogP | -0.34 |
| TPSA | 132.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|