C28H40N6O6 — CID 20512004
2-[6-[[4,6-bis(2-methylprop-2-enoxy)-1,3,5-triazin-2-yl]oxy]hexoxy]-4,6-bis(2-methylprop-2-enoxy)-1,3,5-triazine (PubChem CID 20512004) has the molecular formula C28H40N6O6 and a molecular weight of 556.66 g/mol. Its IUPAC name is 2-[6-[[4,6-bis(2-methylprop-2-enoxy)-1,3,5-triazin-2-yl]oxy]hexoxy]-4,6-bis(2-methylprop-2-enoxy)-1,3,5-triazine.
| Compound Name | 2-[6-[[4,6-bis(2-methylprop-2-enoxy)-1,3,5-triazin-2-yl]oxy]hexoxy]-4,6-bis(2-methylprop-2-enoxy)-1,3,5-triazine |
|---|---|
| PubChem CID | 20512004 |
| Molecular Formula | C28H40N6O6 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | 2-[6-[[4,6-bis(2-methylprop-2-enoxy)-1,3,5-triazin-2-yl]oxy]hexoxy]-4,6-bis(2-methylprop-2-enoxy)-1,3,5-triazine |
| SMILES | C=C(C)COc1nc(OCCCCCCOc2nc(OCC(=C)C)nc(OCC(=C)C)n2)nc(OCC(=C)C)n1 |
| InChI | InChI=1S/C28H40N6O6/c1-19(2)15-37-25-29-23(30-26(33-25)38-16-20(3)4)35-13-11-9-10-12-14-36-24-31-27(39-17-21(5)6)34-28(32-24)40-18-22(7)8/h1,3,5,7,9-18H2,2,4,6,8H3 |
| InChIKey | UYYHKDGNMSBLGS-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 132.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|