C13H17N3O4 — CID 20512049
1-[(2-methyloxiran-2-yl)methyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 20512049) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is 1-[(2-methyloxiran-2-yl)methyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-[(2-methyloxiran-2-yl)methyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 20512049 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 1-[(2-methyloxiran-2-yl)methyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=CCn1c(=O)n(CC=C)c(=O)n(CC2(C)CO2)c1=O |
| InChI | InChI=1S/C13H17N3O4/c1-4-6-14-10(17)15(7-5-2)12(19)16(11(14)18)8-13(3)9-20-13/h4-5H,1-2,6-9H2,3H3 |
| InChIKey | DXUXPBCGEHEQID-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 78.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|