C16H28N2O2 — CID 20512091
4-hydroxy-2,2,6,6-tetramethyl-N,N-bis(prop-2-enyl)piperidine-4-carboxamide (PubChem CID 20512091) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is 4-hydroxy-2,2,6,6-tetramethyl-N,N-bis(prop-2-enyl)piperidine-4-carboxamide.
| Compound Name | 4-hydroxy-2,2,6,6-tetramethyl-N,N-bis(prop-2-enyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20512091 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 4-hydroxy-2,2,6,6-tetramethyl-N,N-bis(prop-2-enyl)piperidine-4-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)C1(O)CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C16H28N2O2/c1-7-9-18(10-8-2)13(19)16(20)11-14(3,4)17-15(5,6)12-16/h7-8,17,20H,1-2,9-12H2,3-6H3 |
| InChIKey | IXFVUJGAKXRXBE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|