C33H62N2O4 — CID 20512096
bis(1-butyl-2,2,6,6-tetramethylpiperidin-4-yl) 2,2-diethylpropanedioate (PubChem CID 20512096) has the molecular formula C33H62N2O4 and a molecular weight of 550.87 g/mol. Its IUPAC name is bis(1-butyl-2,2,6,6-tetramethylpiperidin-4-yl) 2,2-diethylpropanedioate.
| Compound Name | bis(1-butyl-2,2,6,6-tetramethylpiperidin-4-yl) 2,2-diethylpropanedioate |
|---|---|
| PubChem CID | 20512096 |
| Molecular Formula | C33H62N2O4 |
| Molecular Weight | 550.87 g/mol |
| Exact Mass | 550.47 |
| IUPAC Name | bis(1-butyl-2,2,6,6-tetramethylpiperidin-4-yl) 2,2-diethylpropanedioate |
| SMILES | CCCCN1C(C)(C)CC(OC(=O)C(CC)(CC)C(=O)OC2CC(C)(C)N(CCCC)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C33H62N2O4/c1-13-17-19-34-29(5,6)21-25(22-30(34,7)8)38-27(36)33(15-3,16-4)28(37)39-26-23-31(9,10)35(20-18-14-2)32(11,12)24-26/h25-26H,13-24H2,1-12H3 |
| InChIKey | LPYNRFGUZTXBIS-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.87 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|