About 1-methyl-4,5-diphenylpyrrol-2-ol
1-methyl-4,5-diphenylpyrrol-2-ol (PubChem CID 20512182) has the molecular formula C17H15NO
and a molecular weight of 249.31 g/mol. Its IUPAC name is 1-methyl-4,5-diphenylpyrrol-2-ol.
Molecular Properties
| Compound Name | 1-methyl-4,5-diphenylpyrrol-2-ol |
| PubChem CID | 20512182 |
| Molecular Formula | C17H15NO |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 1-methyl-4,5-diphenylpyrrol-2-ol |
| SMILES | Cn1c(O)cc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C17H15NO/c1-18-16(19)12-15(13-8-4-2-5-9-13)17(18)14-10-6-3-7-11-14/h2-12,19H,1H3 |
| InChIKey | MTAQLZYJQRNEDX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methyl-4,5-diphenylpyrrol-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4,5-diphenylpyrrol-2-ol?
The IUPAC name of 1-methyl-4,5-diphenylpyrrol-2-ol (CID 20512182) is 1-methyl-4,5-diphenylpyrrol-2-ol.
What is the SMILES notation for 1-methyl-4,5-diphenylpyrrol-2-ol?
The canonical SMILES for 1-methyl-4,5-diphenylpyrrol-2-ol is Cn1c(O)cc(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of 1-methyl-4,5-diphenylpyrrol-2-ol?
The InChIKey is MTAQLZYJQRNEDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO/c1-18-16(19)12-15(13-8-4-2-5-9-13)17(18)14-10-6-3-7-11-14/h2-12,19H,1H3.
What are the key properties of 1-methyl-4,5-diphenylpyrrol-2-ol?
1-methyl-4,5-diphenylpyrrol-2-ol has a molecular weight of 249.31 g/mol, XLogP of 4.06, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4,5-diphenylpyrrol-2-ol is sourced from PubChem (CID 20512182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).