About 6-amino-3-oxocyclohexa-1,5-diene-1-carboxylic acid
6-amino-3-oxocyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 20512354) has the molecular formula C7H7NO3
and a molecular weight of 153.14 g/mol. Its IUPAC name is 6-amino-3-oxocyclohexa-1,5-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 6-amino-3-oxocyclohexa-1,5-diene-1-carboxylic acid |
| PubChem CID | 20512354 |
| Molecular Formula | C7H7NO3 |
| Molecular Weight | 153.14 g/mol |
| Exact Mass | 153.04 |
| IUPAC Name | 6-amino-3-oxocyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | NC1=CCC(=O)C=C1C(=O)O |
| InChI | InChI=1S/C7H7NO3/c8-6-2-1-4(9)3-5(6)7(10)11/h2-3H,1,8H2,(H,10,11) |
| InChIKey | OATZXXWGEQZWSM-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.14 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-amino-3-oxocyclohexa-1,5-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-3-oxocyclohexa-1,5-diene-1-carboxylic acid?
The IUPAC name of 6-amino-3-oxocyclohexa-1,5-diene-1-carboxylic acid (CID 20512354) is 6-amino-3-oxocyclohexa-1,5-diene-1-carboxylic acid.
What is the SMILES notation for 6-amino-3-oxocyclohexa-1,5-diene-1-carboxylic acid?
The canonical SMILES for 6-amino-3-oxocyclohexa-1,5-diene-1-carboxylic acid is NC1=CCC(=O)C=C1C(=O)O.
What is the InChIKey of 6-amino-3-oxocyclohexa-1,5-diene-1-carboxylic acid?
The InChIKey is OATZXXWGEQZWSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO3/c8-6-2-1-4(9)3-5(6)7(10)11/h2-3H,1,8H2,(H,10,11).
What are the key properties of 6-amino-3-oxocyclohexa-1,5-diene-1-carboxylic acid?
6-amino-3-oxocyclohexa-1,5-diene-1-carboxylic acid has a molecular weight of 153.14 g/mol, XLogP of -0.19, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-3-oxocyclohexa-1,5-diene-1-carboxylic acid is sourced from PubChem (CID 20512354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).