About 3-(4-chlorophenyl)-1-(2,6-dimethylphenyl)-4-methylimidazolidin-2-imine
3-(4-chlorophenyl)-1-(2,6-dimethylphenyl)-4-methylimidazolidin-2-imine (PubChem CID 20512427) has the molecular formula C18H20ClN3
and a molecular weight of 313.83 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-(2,6-dimethylphenyl)-4-methylimidazolidin-2-imine.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-1-(2,6-dimethylphenyl)-4-methylimidazolidin-2-imine |
| PubChem CID | 20512427 |
| Molecular Formula | C18H20ClN3 |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 3-(4-chlorophenyl)-1-(2,6-dimethylphenyl)-4-methylimidazolidin-2-imine |
| SMILES | [H]/N=C1/N(c2c(C)cccc2C)CC(C)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H20ClN3/c1-12-5-4-6-13(2)17(12)21-11-14(3)22(18(21)20)16-9-7-15(19)8-10-16/h4-10,14,20H,11H2,1-3H3/b20-18- |
| InChIKey | ANICMCIRXCKOAV-ZZEZOPTASA-N |
| XLogP | 4.61 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-chlorophenyl)-1-(2,6-dimethylphenyl)-4-methylimidazolidin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-1-(2,6-dimethylphenyl)-4-methylimidazolidin-2-imine?
The IUPAC name of 3-(4-chlorophenyl)-1-(2,6-dimethylphenyl)-4-methylimidazolidin-2-imine (CID 20512427) is 3-(4-chlorophenyl)-1-(2,6-dimethylphenyl)-4-methylimidazolidin-2-imine.
What is the SMILES notation for 3-(4-chlorophenyl)-1-(2,6-dimethylphenyl)-4-methylimidazolidin-2-imine?
The canonical SMILES for 3-(4-chlorophenyl)-1-(2,6-dimethylphenyl)-4-methylimidazolidin-2-imine is [H]/N=C1/N(c2c(C)cccc2C)CC(C)N1c1ccc(Cl)cc1.
What is the InChIKey of 3-(4-chlorophenyl)-1-(2,6-dimethylphenyl)-4-methylimidazolidin-2-imine?
The InChIKey is ANICMCIRXCKOAV-ZZEZOPTASA-N. The full InChI is InChI=1S/C18H20ClN3/c1-12-5-4-6-13(2)17(12)21-11-14(3)22(18(21)20)16-9-7-15(19)8-10-16/h4-10,14,20H,11H2,1-3H3/b20-18-.
What are the key properties of 3-(4-chlorophenyl)-1-(2,6-dimethylphenyl)-4-methylimidazolidin-2-imine?
3-(4-chlorophenyl)-1-(2,6-dimethylphenyl)-4-methylimidazolidin-2-imine has a molecular weight of 313.83 g/mol, XLogP of 4.61, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-1-(2,6-dimethylphenyl)-4-methylimidazolidin-2-imine is sourced from PubChem (CID 20512427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).