About 1,2,2-triethyloxan-1-ium
1,2,2-triethyloxan-1-ium (PubChem CID 20512699) has the molecular formula C11H23O+
and a molecular weight of 171.30 g/mol. Its IUPAC name is 1,2,2-triethyloxan-1-ium.
Molecular Properties
| Compound Name | 1,2,2-triethyloxan-1-ium |
| PubChem CID | 20512699 |
| Molecular Formula | C11H23O+ |
| Molecular Weight | 171.30 g/mol |
| Exact Mass | 171.17 |
| IUPAC Name | 1,2,2-triethyloxan-1-ium |
| SMILES | CC[O+]1CCCCC1(CC)CC |
| InChI | InChI=1S/C11H23O/c1-4-11(5-2)9-7-8-10-12(11)6-3/h4-10H2,1-3H3/q+1 |
| InChIKey | FXEOMKCENKQOJW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 2.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 1,2,2-triethyloxan-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,2-triethyloxan-1-ium?
The IUPAC name of 1,2,2-triethyloxan-1-ium (CID 20512699) is 1,2,2-triethyloxan-1-ium.
What is the SMILES notation for 1,2,2-triethyloxan-1-ium?
The canonical SMILES for 1,2,2-triethyloxan-1-ium is CC[O+]1CCCCC1(CC)CC.
What is the InChIKey of 1,2,2-triethyloxan-1-ium?
The InChIKey is FXEOMKCENKQOJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23O/c1-4-11(5-2)9-7-8-10-12(11)6-3/h4-10H2,1-3H3/q+1.
What are the key properties of 1,2,2-triethyloxan-1-ium?
1,2,2-triethyloxan-1-ium has a molecular weight of 171.30 g/mol, XLogP of 3.30, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,2-triethyloxan-1-ium is sourced from PubChem (CID 20512699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).