About [1-hydroxy-2,2-bis(hydroxymethyl)-4-oxohex-5-en-3-yl] prop-2-enoate
[1-hydroxy-2,2-bis(hydroxymethyl)-4-oxohex-5-en-3-yl] prop-2-enoate (PubChem CID 20512784) has the molecular formula C11H16O6
and a molecular weight of 244.24 g/mol. Its IUPAC name is [1-hydroxy-2,2-bis(hydroxymethyl)-4-oxohex-5-en-3-yl] prop-2-enoate.
Molecular Properties
| Compound Name | [1-hydroxy-2,2-bis(hydroxymethyl)-4-oxohex-5-en-3-yl] prop-2-enoate |
| PubChem CID | 20512784 |
| Molecular Formula | C11H16O6 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | [1-hydroxy-2,2-bis(hydroxymethyl)-4-oxohex-5-en-3-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC(C(=O)C=C)C(CO)(CO)CO |
| InChI | InChI=1S/C11H16O6/c1-3-8(15)10(17-9(16)4-2)11(5-12,6-13)7-14/h3-4,10,12-14H,1-2,5-7H2 |
| InChIKey | HUZFVRZCDSZUMH-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [1-hydroxy-2,2-bis(hydroxymethyl)-4-oxohex-5-en-3-yl] prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-hydroxy-2,2-bis(hydroxymethyl)-4-oxohex-5-en-3-yl] prop-2-enoate?
The IUPAC name of [1-hydroxy-2,2-bis(hydroxymethyl)-4-oxohex-5-en-3-yl] prop-2-enoate (CID 20512784) is [1-hydroxy-2,2-bis(hydroxymethyl)-4-oxohex-5-en-3-yl] prop-2-enoate.
What is the SMILES notation for [1-hydroxy-2,2-bis(hydroxymethyl)-4-oxohex-5-en-3-yl] prop-2-enoate?
The canonical SMILES for [1-hydroxy-2,2-bis(hydroxymethyl)-4-oxohex-5-en-3-yl] prop-2-enoate is C=CC(=O)OC(C(=O)C=C)C(CO)(CO)CO.
What is the InChIKey of [1-hydroxy-2,2-bis(hydroxymethyl)-4-oxohex-5-en-3-yl] prop-2-enoate?
The InChIKey is HUZFVRZCDSZUMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O6/c1-3-8(15)10(17-9(16)4-2)11(5-12,6-13)7-14/h3-4,10,12-14H,1-2,5-7H2.
What are the key properties of [1-hydroxy-2,2-bis(hydroxymethyl)-4-oxohex-5-en-3-yl] prop-2-enoate?
[1-hydroxy-2,2-bis(hydroxymethyl)-4-oxohex-5-en-3-yl] prop-2-enoate has a molecular weight of 244.24 g/mol, XLogP of -1.20, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-hydroxy-2,2-bis(hydroxymethyl)-4-oxohex-5-en-3-yl] prop-2-enoate is sourced from PubChem (CID 20512784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).