C8H16O7 — CID 20512830
2-(2,3-dihydroxypropoxy)oxane-3,4,5-triol (PubChem CID 20512830) has the molecular formula C8H16O7 and a molecular weight of 224.21 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropoxy)oxane-3,4,5-triol.
| Compound Name | 2-(2,3-dihydroxypropoxy)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 20512830 |
| Molecular Formula | C8H16O7 |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 2-(2,3-dihydroxypropoxy)oxane-3,4,5-triol |
| SMILES | OCC(O)COC1OCC(O)C(O)C1O |
| InChI | InChI=1S/C8H16O7/c9-1-4(10)2-14-8-7(13)6(12)5(11)3-15-8/h4-13H,1-3H2 |
| InChIKey | BZQBQGKZJCGZCL-UHFFFAOYSA-N |
| XLogP | -3.20 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |